C17H14O9S4 — CID 20715611
dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 20715611) has the molecular formula C17H14O9S4 and a molecular weight of 490.56 g/mol. Its IUPAC name is dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 20715611 |
| Molecular Formula | C17H14O9S4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC(=O)C=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C17H14O9S4/c1-23-14(19)10-11(15(20)24-2)28-8(27-10)5-7(18)6-9-29-12(16(21)25-3)13(30-9)17(22)26-4/h5-6H,1-4H3 |
| InChIKey | UYGISDRCBCVWQJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|