C20H20O10S4 — CID 101350898
dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-dimethoxybut-2-enylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101350898) has the molecular formula C20H20O10S4 and a molecular weight of 548.64 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-dimethoxybut-2-enylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-dimethoxybut-2-enylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101350898 |
| Molecular Formula | C20H20O10S4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-dimethoxybut-2-enylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C/C(OC)=C(/C=C2SC(C(=O)OC)=C(C(=O)OC)S2)OC)S1 |
| InChI | InChI=1S/C20H20O10S4/c1-25-9(7-11-31-13(17(21)27-3)14(32-11)18(22)28-4)10(26-2)8-12-33-15(19(23)29-5)16(34-12)20(24)30-6/h7-8H,1-6H3/b10-9+ |
| InChIKey | NRQRWQWBDYFUKO-MDZDMXLPSA-N |
| XLogP | 3.25 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|