C18H16O8S4 — CID 13120079
dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 13120079) has the molecular formula C18H16O8S4 and a molecular weight of 488.59 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 13120079 |
| Molecular Formula | C18H16O8S4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | dimethyl 2-[(E)-4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C/C=C/C=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C18H16O8S4/c1-23-15(19)11-12(16(20)24-2)28-9(27-11)7-5-6-8-10-29-13(17(21)25-3)14(30-10)18(22)26-4/h5-8H,1-4H3/b6-5+ |
| InChIKey | VZBNKENBJAZTJX-AATRIKPKSA-N |
| XLogP | 3.30 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|