C19H18O8S4 — CID 10696801
dimethyl 2-[(E)-5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]pent-3-enylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 10696801) has the molecular formula C19H18O8S4 and a molecular weight of 502.61 g/mol. Its IUPAC name is dimethyl 2-[(E)-5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]pent-3-enylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]pent-3-enylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10696801 |
| Molecular Formula | C19H18O8S4 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | dimethyl 2-[(E)-5-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]pent-3-enylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C/C=C/CC=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C19H18O8S4/c1-24-16(20)12-13(17(21)25-2)29-10(28-12)8-6-5-7-9-11-30-14(18(22)26-3)15(31-11)19(23)27-4/h5-6,8-9H,7H2,1-4H3/b6-5+ |
| InChIKey | RCHOPRDPYPZMAM-AATRIKPKSA-N |
| XLogP | 3.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|