C10H8O2S4 — CID 15194392
methyl (E)-3-[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]prop-2-enoate (PubChem CID 15194392) has the molecular formula C10H8O2S4 and a molecular weight of 288.44 g/mol. Its IUPAC name is methyl (E)-3-[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15194392 |
| Molecular Formula | C10H8O2S4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | methyl (E)-3-[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=CSC(=C2SC=CS2)S1 |
| InChI | InChI=1S/C10H8O2S4/c1-12-8(11)3-2-7-6-15-10(16-7)9-13-4-5-14-9/h2-6H,1H3/b3-2+ |
| InChIKey | YURSCZHWDRYSGL-NSCUHMNNSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|