C17H12O10S2W — CID 11411025
[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1-methoxybut-3-enylidene]tungsten;carbon monoxide (PubChem CID 11411025) has the molecular formula C17H12O10S2W and a molecular weight of 624.25 g/mol. Its IUPAC name is [2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1-methoxybut-3-enylidene]tungsten;carbon monoxide.
| Compound Name | [2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1-methoxybut-3-enylidene]tungsten;carbon monoxide |
|---|---|
| PubChem CID | 11411025 |
| Molecular Formula | C17H12O10S2W |
| Molecular Weight | 624.25 g/mol |
| Exact Mass | 623.94 |
| IUPAC Name | [2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1-methoxybut-3-enylidene]tungsten;carbon monoxide |
| SMILES | C=CC(C(=[W])OC)=C1SC(C(=O)OC)=C(C(=O)OC)S1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C12H12O5S2.5CO.W/c1-5-7(6-15-2)12-18-8(10(13)16-3)9(19-12)11(14)17-4;5*1-2;/h5H,1H2,2-4H3;;;;;; |
| InChIKey | WCXSDJJRQTYKHH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 161.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|