C12H10O4S2Se — CID 14091568
dimethyl 2-selenopyran-4-ylidene-1,3-dithiole-4,5-dicarboxylate (PubChem CID 14091568) has the molecular formula C12H10O4S2Se and a molecular weight of 361.30 g/mol. Its IUPAC name is dimethyl 2-selenopyran-4-ylidene-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-selenopyran-4-ylidene-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 14091568 |
| Molecular Formula | C12H10O4S2Se |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | dimethyl 2-selenopyran-4-ylidene-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C=C[Se]C=C2)S1 |
| InChI | InChI=1S/C12H10O4S2Se/c1-15-10(13)8-9(11(14)16-2)18-12(17-8)7-3-5-19-6-4-7/h3-6H,1-2H3 |
| InChIKey | WPLXOTQWXRUZIU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|