C18H14O4S6Se2 — CID 10875992
dimethyl 2-[3-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 10875992) has the molecular formula C18H14O4S6Se2 and a molecular weight of 644.63 g/mol. Its IUPAC name is dimethyl 2-[3-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[3-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10875992 |
| Molecular Formula | C18H14O4S6Se2 |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 645.75 |
| IUPAC Name | dimethyl 2-[3-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC(C=C2SC3=C(SCCS3)S2)=C2[Se]C=C[Se]2)S1 |
| InChI | InChI=1S/C18H14O4S6Se2/c1-21-14(19)12-13(15(20)22-2)26-10(25-12)7-9(18-29-5-6-30-18)8-11-27-16-17(28-11)24-4-3-23-16/h5-8H,3-4H2,1-2H3 |
| InChIKey | XSKCHLBDOZLKLO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|