C16H12O4S8 — CID 101022842
dimethyl 2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101022842) has the molecular formula C16H12O4S8 and a molecular weight of 524.80 g/mol. Its IUPAC name is dimethyl 2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101022842 |
| Molecular Formula | C16H12O4S8 |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 523.85 |
| IUPAC Name | dimethyl 2-[[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC2=CSC(=C3SC4=C(SCCS4)S3)S2)S1 |
| InChI | InChI=1S/C16H12O4S8/c1-19-11(17)9-10(12(18)20-2)26-8(25-9)5-7-6-23-15(24-7)16-27-13-14(28-16)22-4-3-21-13/h5-6H,3-4H2,1-2H3 |
| InChIKey | LHLCBOIHCWNEAB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'} |
|---|