C14H12O4S4 — CID 102120476
dimethyl 2-[(E)-4-(1,3-dithiol-2-ylidene)but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102120476) has the molecular formula C14H12O4S4 and a molecular weight of 372.51 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-(1,3-dithiol-2-ylidene)but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-4-(1,3-dithiol-2-ylidene)but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102120476 |
| Molecular Formula | C14H12O4S4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | dimethyl 2-[(E)-4-(1,3-dithiol-2-ylidene)but-2-enylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C/C=C/C=C2SC=CS2)S1 |
| InChI | InChI=1S/C14H12O4S4/c1-17-13(15)11-12(14(16)18-2)22-10(21-11)6-4-3-5-9-19-7-8-20-9/h3-8H,1-2H3/b4-3+ |
| InChIKey | SROMLAGKQVOQCA-ONEGZZNKSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'} |
|---|