C22H16O8S8 — CID 177422913
dimethyl 2-[[(2Z)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 177422913) has the molecular formula C22H16O8S8 and a molecular weight of 664.90 g/mol. Its IUPAC name is dimethyl 2-[[(2Z)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[[(2Z)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 177422913 |
| Molecular Formula | C22H16O8S8 |
| Molecular Weight | 664.90 g/mol |
| Exact Mass | 663.86 |
| IUPAC Name | dimethyl 2-[[(2Z)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC2=CS/C(=C3\SC=C(C=C4SC(C(=O)OC)=C(C(=O)OC)S4)S3)S2)S1 |
| InChI | InChI=1S/C22H16O8S8/c1-27-17(23)13-14(18(24)28-2)36-11(35-13)5-9-7-31-21(33-9)22-32-8-10(34-22)6-12-37-15(19(25)29-3)16(38-12)20(26)30-4/h5-8H,1-4H3/b22-21- |
| InChIKey | UPEBMIMAPKOADS-DQRAZIAOSA-N |
| XLogP | 6.51 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.90 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|