C22H22O4S10 — CID 11765040
methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[2-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiole-4-carboxylate (PubChem CID 11765040) has the molecular formula C22H22O4S10 and a molecular weight of 671.08 g/mol. Its IUPAC name is methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[2-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiole-4-carboxylate.
| Compound Name | methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[2-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 11765040 |
| Molecular Formula | C22H22O4S10 |
| Molecular Weight | 671.08 g/mol |
| Exact Mass | 669.87 |
| IUPAC Name | methyl 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-[2-[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methoxycarbonyl-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=C(SCCSC2=C(C(=O)OC)SC(=C3SC(C)=C(C)S3)S2)SC(=C2SC(C)=C(C)S2)S1 |
| InChI | InChI=1S/C22H22O4S10/c1-9-10(2)30-19(29-9)21-33-13(15(23)25-5)17(35-21)27-7-8-28-18-14(16(24)26-6)34-22(36-18)20-31-11(3)12(4)32-20/h7-8H2,1-6H3 |
| InChIKey | BWJWRHZFFXKUGG-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.08 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|