C20H18O4S10 — CID 10349205
5-[2-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid (PubChem CID 10349205) has the molecular formula C20H18O4S10 and a molecular weight of 643.03 g/mol. Its IUPAC name is 5-[2-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid.
| Compound Name | 5-[2-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid |
|---|---|
| PubChem CID | 10349205 |
| Molecular Formula | C20H18O4S10 |
| Molecular Weight | 643.03 g/mol |
| Exact Mass | 641.84 |
| IUPAC Name | 5-[2-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]ethylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid |
| SMILES | CC1=C(C)SC(=C2SC(SCCSC3=C(C(=O)O)SC(=C4SC(C)=C(C)S4)S3)=C(C(=O)O)S2)S1 |
| InChI | InChI=1S/C20H18O4S10/c1-7-8(2)28-17(27-7)19-31-11(13(21)22)15(33-19)25-5-6-26-16-12(14(23)24)32-20(34-16)18-29-9(3)10(4)30-18/h5-6H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | UTWYEWCNAZTVTJ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.03 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|