C22H22O4S10 — CID 10484603
5-[4-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid (PubChem CID 10484603) has the molecular formula C22H22O4S10 and a molecular weight of 671.08 g/mol. Its IUPAC name is 5-[4-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid.
| Compound Name | 5-[4-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid |
|---|---|
| PubChem CID | 10484603 |
| Molecular Formula | C22H22O4S10 |
| Molecular Weight | 671.08 g/mol |
| Exact Mass | 669.87 |
| IUPAC Name | 5-[4-[[5-carboxy-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]butylsulfanyl]-2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylic acid |
| SMILES | CC1=C(C)SC(=C2SC(SCCCCSC3=C(C(=O)O)SC(=C4SC(C)=C(C)S4)S3)=C(C(=O)O)S2)S1 |
| InChI | InChI=1S/C22H22O4S10/c1-9-10(2)30-19(29-9)21-33-13(15(23)24)17(35-21)27-7-5-6-8-28-18-14(16(25)26)34-22(36-18)20-31-11(3)12(4)32-20/h5-8H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | UNFSISFQLQIKDE-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.08 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|