C13H10O5S2Se2 — CID 11762416
dimethyl 2-[2-(1,3-diselenol-2-ylidene)-3-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11762416) has the molecular formula C13H10O5S2Se2 and a molecular weight of 468.27 g/mol. Its IUPAC name is dimethyl 2-[2-(1,3-diselenol-2-ylidene)-3-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-(1,3-diselenol-2-ylidene)-3-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11762416 |
| Molecular Formula | C13H10O5S2Se2 |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 469.83 |
| IUPAC Name | dimethyl 2-[2-(1,3-diselenol-2-ylidene)-3-oxopropylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC(C=O)=C2[Se]C=C[Se]2)S1 |
| InChI | InChI=1S/C13H10O5S2Se2/c1-17-11(15)9-10(12(16)18-2)20-8(19-9)5-7(6-14)13-21-3-4-22-13/h3-6H,1-2H3 |
| InChIKey | SBTCIPTVDXNVQY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|