C16H15NOS — CID 177457671
(3E)-1-methyl-3-[(4-methylphenyl)methylidene]-1,2-benzothiazole 1-oxide (PubChem CID 177457671) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is (3E)-1-methyl-3-[(4-methylphenyl)methylidene]-1,2-benzothiazole 1-oxide.
| Compound Name | (3E)-1-methyl-3-[(4-methylphenyl)methylidene]-1,2-benzothiazole 1-oxide |
|---|---|
| PubChem CID | 177457671 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (3E)-1-methyl-3-[(4-methylphenyl)methylidene]-1,2-benzothiazole 1-oxide |
| SMILES | Cc1ccc(/C=C2/N=S(C)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C16H15NOS/c1-12-7-9-13(10-8-12)11-15-14-5-3-4-6-16(14)19(2,18)17-15/h3-11H,1-2H3/b15-11+ |
| InChIKey | AMDHHLXQQNRXNY-RVDMUPIBSA-N |
| XLogP | 3.96 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|