C39H37N9O4 — CID 177459304
3-N,5-N-bis[(2S)-1-oxo-3-phenyl-1-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]propan-2-yl]pyridine-3,5-dicarboxamide (PubChem CID 177459304) has the molecular formula C39H37N9O4 and a molecular weight of 695.78 g/mol. Its IUPAC name is 3-N,5-N-bis[(2S)-1-oxo-3-phenyl-1-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]propan-2-yl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[(2S)-1-oxo-3-phenyl-1-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]propan-2-yl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 177459304 |
| Molecular Formula | C39H37N9O4 |
| Molecular Weight | 695.78 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 3-N,5-N-bis[(2S)-1-oxo-3-phenyl-1-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]propan-2-yl]pyridine-3,5-dicarboxamide |
| SMILES | C/C(=N\NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cncc(C(=O)N[C@@H](Cc2ccccc2)C(=O)N/N=C(\C)c2ccccn2)c1)c1ccccn1 |
| InChI | InChI=1S/C39H37N9O4/c1-26(32-17-9-11-19-41-32)45-47-38(51)34(21-28-13-5-3-6-14-28)43-36(49)30-23-31(25-40-24-30)37(50)44-35(22-29-15-7-4-8-16-29)39(52)48-46-27(2)33-18-10-12-20-42-33/h3-20,23-25,34-35H,21-22H2,1-2H3,(H,43,49)(H,44,50)(H,47,51)(H,48,52)/b45-26+,46-27+/t34-,35-/m0/s1 |
| InChIKey | XVNNJEIIDNZVRL-RGPHWLNHSA-N |
| XLogP | 3.63 |
| TPSA | 179.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|