C24H43O6P — CID 177459721
(3,4,5-trihexoxyphenyl)phosphonic acid (PubChem CID 177459721) has the molecular formula C24H43O6P and a molecular weight of 458.58 g/mol. Its IUPAC name is (3,4,5-trihexoxyphenyl)phosphonic acid.
| Compound Name | (3,4,5-trihexoxyphenyl)phosphonic acid |
|---|---|
| PubChem CID | 177459721 |
| Molecular Formula | C24H43O6P |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | (3,4,5-trihexoxyphenyl)phosphonic acid |
| SMILES | CCCCCCOc1cc(P(=O)(O)O)cc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C24H43O6P/c1-4-7-10-13-16-28-22-19-21(31(25,26)27)20-23(29-17-14-11-8-5-2)24(22)30-18-15-12-9-6-3/h19-20H,4-18H2,1-3H3,(H2,25,26,27) |
| InChIKey | IVBTYUWRPQCZHT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|