C27H29NO — CID 177459724
(E)-3-[2,6-di(propan-2-yl)anilino]-1-(2-phenylphenyl)prop-2-en-1-one (PubChem CID 177459724) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is (E)-3-[2,6-di(propan-2-yl)anilino]-1-(2-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2,6-di(propan-2-yl)anilino]-1-(2-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 177459724 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (E)-3-[2,6-di(propan-2-yl)anilino]-1-(2-phenylphenyl)prop-2-en-1-one |
| SMILES | CC(C)c1cccc(C(C)C)c1N/C=C/C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H29NO/c1-19(2)22-15-10-16-23(20(3)4)27(22)28-18-17-26(29)25-14-9-8-13-24(25)21-11-6-5-7-12-21/h5-20,28H,1-4H3/b18-17+ |
| InChIKey | ZDZLCRHKUZLVBH-ISLYRVAYSA-N |
| XLogP | 7.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|