About (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one
(1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one (PubChem CID 177463586) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one.
Molecular Properties
| Compound Name | (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one |
| PubChem CID | 177463586 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one |
| SMILES | CCC(=O)/C(=C1\CC(C)(C)CN1)c1ccccc1 |
| InChI | InChI=1S/C16H21NO/c1-4-14(18)15(12-8-6-5-7-9-12)13-10-16(2,3)11-17-13/h5-9,17H,4,10-11H2,1-3H3/b15-13+ |
| InChIKey | PQSFVCWEXGHACL-FYWRMAATSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one?
The IUPAC name of (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one (CID 177463586) is (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one.
What is the SMILES notation for (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one?
The canonical SMILES for (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one is CCC(=O)/C(=C1\CC(C)(C)CN1)c1ccccc1.
What is the InChIKey of (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one?
The InChIKey is PQSFVCWEXGHACL-FYWRMAATSA-N. The full InChI is InChI=1S/C16H21NO/c1-4-14(18)15(12-8-6-5-7-9-12)13-10-16(2,3)11-17-13/h5-9,17H,4,10-11H2,1-3H3/b15-13+.
What are the key properties of (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one?
(1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one has a molecular weight of 243.35 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(4,4-dimethylpyrrolidin-2-ylidene)-1-phenylbutan-2-one is sourced from PubChem (CID 177463586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).