C16H32N2O10P2 — CID 177464082
(Z,1Z)-1,4-bis[di(propan-2-yloxy)phosphoryl]-3-hydroxy-4-(hydroxyamino)-1-hydroxyiminobut-3-en-2-one (PubChem CID 177464082) has the molecular formula C16H32N2O10P2 and a molecular weight of 474.38 g/mol. Its IUPAC name is (Z,1Z)-1,4-bis[di(propan-2-yloxy)phosphoryl]-3-hydroxy-4-(hydroxyamino)-1-hydroxyiminobut-3-en-2-one.
| Compound Name | (Z,1Z)-1,4-bis[di(propan-2-yloxy)phosphoryl]-3-hydroxy-4-(hydroxyamino)-1-hydroxyiminobut-3-en-2-one |
|---|---|
| PubChem CID | 177464082 |
| Molecular Formula | C16H32N2O10P2 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (Z,1Z)-1,4-bis[di(propan-2-yloxy)phosphoryl]-3-hydroxy-4-(hydroxyamino)-1-hydroxyiminobut-3-en-2-one |
| SMILES | CC(C)OP(=O)(OC(C)C)/C(=N\O)C(=O)/C(O)=C(\NO)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H32N2O10P2/c1-9(2)25-29(23,26-10(3)4)15(17-21)13(19)14(20)16(18-22)30(24,27-11(5)6)28-12(7)8/h9-12,17,19,21-22H,1-8H3/b15-13-,18-16- |
| InChIKey | KGJMYZACNQRJFS-ALKJTPJRSA-N |
| XLogP | 4.14 |
| TPSA | 173.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|