C11H24NO4P — CID 4204254
1-di(propan-2-yloxy)phosphoryl-N,N-diethylformamide (PubChem CID 4204254) has the molecular formula C11H24NO4P and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-di(propan-2-yloxy)phosphoryl-N,N-diethylformamide.
| Compound Name | 1-di(propan-2-yloxy)phosphoryl-N,N-diethylformamide |
|---|---|
| PubChem CID | 4204254 |
| Molecular Formula | C11H24NO4P |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1-di(propan-2-yloxy)phosphoryl-N,N-diethylformamide |
| SMILES | CCN(CC)C(=O)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C11H24NO4P/c1-7-12(8-2)11(13)17(14,15-9(3)4)16-10(5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | HWXJNHWOYQIWNJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|