About 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine
2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine (PubChem CID 177465729) has the molecular formula C28H18N4
and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine |
| PubChem CID | 177465729 |
| Molecular Formula | C28H18N4 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine |
| SMILES | c1ccc(-c2ccc3cc(-c4ccc5ccc(-c6ccccc6)nc5n4)cnc3n2)cc1 |
| InChI | InChI=1S/C28H18N4/c1-3-7-19(8-4-1)24-16-13-22-17-23(18-29-27(22)30-24)26-15-12-21-11-14-25(31-28(21)32-26)20-9-5-2-6-10-20/h1-18H |
| InChIKey | ARHBQZWTLJTXAI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine?
The IUPAC name of 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine (CID 177465729) is 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine.
What is the SMILES notation for 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine?
The canonical SMILES for 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine is c1ccc(-c2ccc3cc(-c4ccc5ccc(-c6ccccc6)nc5n4)cnc3n2)cc1.
What is the InChIKey of 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine?
The InChIKey is ARHBQZWTLJTXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18N4/c1-3-7-19(8-4-1)24-16-13-22-17-23(18-29-27(22)30-24)26-15-12-21-11-14-25(31-28(21)32-26)20-9-5-2-6-10-20/h1-18H.
What are the key properties of 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine?
2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine has a molecular weight of 410.48 g/mol, XLogP of 6.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6-(7-phenyl-1,8-naphthyridin-2-yl)-1,8-naphthyridine is sourced from PubChem (CID 177465729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).