C18H12N4 — CID 72544350
3-phenyl-7-pyridin-3-ylpyrido[2,3-b]pyrazine (PubChem CID 72544350) has the molecular formula C18H12N4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-phenyl-7-pyridin-3-ylpyrido[2,3-b]pyrazine.
| Compound Name | 3-phenyl-7-pyridin-3-ylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 72544350 |
| Molecular Formula | C18H12N4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-phenyl-7-pyridin-3-ylpyrido[2,3-b]pyrazine |
| SMILES | c1ccc(-c2cnc3cc(-c4cccnc4)cnc3n2)cc1 |
| InChI | InChI=1S/C18H12N4/c1-2-5-13(6-3-1)17-12-20-16-9-15(11-21-18(16)22-17)14-7-4-8-19-10-14/h1-12H |
| InChIKey | HJAXGUYZLLHGQD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |