C17H18O2S — CID 177470262
(1R,4R)-4-(benzenesulfinyl)-1-phenylpent-2-en-1-ol (PubChem CID 177470262) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is (1R,4R)-4-(benzenesulfinyl)-1-phenylpent-2-en-1-ol.
| Compound Name | (1R,4R)-4-(benzenesulfinyl)-1-phenylpent-2-en-1-ol |
|---|---|
| PubChem CID | 177470262 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (1R,4R)-4-(benzenesulfinyl)-1-phenylpent-2-en-1-ol |
| SMILES | C[C@H](C=C[C@@H](O)c1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O2S/c1-14(20(19)16-10-6-3-7-11-16)12-13-17(18)15-8-4-2-5-9-15/h2-14,17-18H,1H3/t14-,17-,20?/m1/s1 |
| InChIKey | BGXCLHVIYKJUHP-TUYPYBPCSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|