C11H14O2 — CID 131244712
(E,1R,4R)-1-phenylpent-2-ene-1,4-diol (PubChem CID 131244712) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (E,1R,4R)-1-phenylpent-2-ene-1,4-diol.
| Compound Name | (E,1R,4R)-1-phenylpent-2-ene-1,4-diol |
|---|---|
| PubChem CID | 131244712 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (E,1R,4R)-1-phenylpent-2-ene-1,4-diol |
| SMILES | C[C@@H](O)/C=C/[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-9(12)7-8-11(13)10-5-3-2-4-6-10/h2-9,11-13H,1H3/b8-7+/t9-,11-/m1/s1 |
| InChIKey | YSSADZOOZXJLIM-FQZVFUSHSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|