C22H15N3O4 — CID 177471296
2-[[(E)-(4-nitrophenyl)methylideneamino]-phenylmethyl]isoindole-1,3-dione (PubChem CID 177471296) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[[(E)-(4-nitrophenyl)methylideneamino]-phenylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[[(E)-(4-nitrophenyl)methylideneamino]-phenylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177471296 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[[(E)-(4-nitrophenyl)methylideneamino]-phenylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C(/N=C/c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C22H15N3O4/c26-21-18-8-4-5-9-19(18)22(27)24(21)20(16-6-2-1-3-7-16)23-14-15-10-12-17(13-11-15)25(28)29/h1-14,20H/b23-14+ |
| InChIKey | QKCKARODWDZEIW-OEAKJJBVSA-N |
| XLogP | 4.01 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|