C16H16O3S — CID 177472438
4-(4-methoxyphenyl)-3,4-dihydro-2H-thiochromene 1,1-dioxide (PubChem CID 177472438) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3,4-dihydro-2H-thiochromene 1,1-dioxide.
| Compound Name | 4-(4-methoxyphenyl)-3,4-dihydro-2H-thiochromene 1,1-dioxide |
|---|---|
| PubChem CID | 177472438 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-(4-methoxyphenyl)-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| SMILES | COc1ccc(C2CCS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C16H16O3S/c1-19-13-8-6-12(7-9-13)14-10-11-20(17,18)16-5-3-2-4-15(14)16/h2-9,14H,10-11H2,1H3 |
| InChIKey | CZPHGIAXCSQLOY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |