C31H42Si — CID 177473437
8-(3-ethylundecan-3-yl)-11,11-dimethylnaphtho[1,2-b][1]benzosilole (PubChem CID 177473437) has the molecular formula C31H42Si and a molecular weight of 442.76 g/mol. Its IUPAC name is 8-(3-ethylundecan-3-yl)-11,11-dimethylnaphtho[1,2-b][1]benzosilole.
| Compound Name | 8-(3-ethylundecan-3-yl)-11,11-dimethylnaphtho[1,2-b][1]benzosilole |
|---|---|
| PubChem CID | 177473437 |
| Molecular Formula | C31H42Si |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 8-(3-ethylundecan-3-yl)-11,11-dimethylnaphtho[1,2-b][1]benzosilole |
| SMILES | CCCCCCCCC(CC)(CC)c1ccc2c(c1)-c1ccc3ccccc3c1[Si]2(C)C |
| InChI | InChI=1S/C31H42Si/c1-6-9-10-11-12-15-22-31(7-2,8-3)25-19-21-29-28(23-25)27-20-18-24-16-13-14-17-26(24)30(27)32(29,4)5/h13-14,16-21,23H,6-12,15,22H2,1-5H3 |
| InChIKey | WSPDOUYGJXRMLU-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|