C14H22S2 — CID 177474425
10-pent-4-enyl-1,5-dithiaspiro[5.5]undec-10-ene (PubChem CID 177474425) has the molecular formula C14H22S2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 10-pent-4-enyl-1,5-dithiaspiro[5.5]undec-10-ene.
| Compound Name | 10-pent-4-enyl-1,5-dithiaspiro[5.5]undec-10-ene |
|---|---|
| PubChem CID | 177474425 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 10-pent-4-enyl-1,5-dithiaspiro[5.5]undec-10-ene |
| SMILES | C=CCCCC1=CC2(CCC1)SCCCS2 |
| InChI | InChI=1S/C14H22S2/c1-2-3-4-7-13-8-5-9-14(12-13)15-10-6-11-16-14/h2,12H,1,3-11H2 |
| InChIKey | XIKMWHCFOLJOJX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|