C14H21NO6 — CID 177474829
(1R,5R)-4-hydroxy-1-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]-4-(2-methylpropyl)-6-oxa-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 177474829) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is (1R,5R)-4-hydroxy-1-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]-4-(2-methylpropyl)-6-oxa-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,5R)-4-hydroxy-1-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]-4-(2-methylpropyl)-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 177474829 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (1R,5R)-4-hydroxy-1-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]-4-(2-methylpropyl)-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CC(C)CC1(O)NC(=O)[C@@]2(C(=O)CC3(C)OCCO3)O[C@@H]12 |
| InChI | InChI=1S/C14H21NO6/c1-8(2)6-13(18)10-14(21-10,11(17)15-13)9(16)7-12(3)19-4-5-20-12/h8,10,18H,4-7H2,1-3H3,(H,15,17)/t10-,13?,14-/m0/s1 |
| InChIKey | IRPFGZSOUSDKMT-LZRTYROISA-N |
| XLogP | -0.29 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|