C29H40O5 — CID 177475572
[(1S,5S,9S,10R,12R,14R)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (2E,4Z)-deca-2,4-dienoate (PubChem CID 177475572) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is [(1S,5S,9S,10R,12R,14R)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (2E,4Z)-deca-2,4-dienoate.
| Compound Name | [(1S,5S,9S,10R,12R,14R)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (2E,4Z)-deca-2,4-dienoate |
|---|---|
| PubChem CID | 177475572 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | [(1S,5S,9S,10R,12R,14R)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-7-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (2E,4Z)-deca-2,4-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)OC1=C[C@H]2C(=O)[C@]3(C=C(C)C[C@@]3(O)C1O)[C@H](C)C[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C29H40O5/c1-6-7-8-9-10-11-12-13-23(30)34-22-15-20-24-21(27(24,4)5)14-19(3)28(25(20)31)16-18(2)17-29(28,33)26(22)32/h10-13,15-16,19-21,24,26,32-33H,6-9,14,17H2,1-5H3/b11-10-,13-12+/t19-,20-,21-,24+,26?,28+,29-/m1/s1 |
| InChIKey | DRGZAVCEWRPVCH-WTKJVLBYSA-N |
| XLogP | 5.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|