C12H15NO3 — CID 177475971
N-[(2R,3S)-2,3-dihydroxypent-4-enyl]-1-phenylmethanimine oxide (PubChem CID 177475971) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[(2R,3S)-2,3-dihydroxypent-4-enyl]-1-phenylmethanimine oxide.
| Compound Name | N-[(2R,3S)-2,3-dihydroxypent-4-enyl]-1-phenylmethanimine oxide |
|---|---|
| PubChem CID | 177475971 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[(2R,3S)-2,3-dihydroxypent-4-enyl]-1-phenylmethanimine oxide |
| SMILES | C=C[C@H](O)[C@H](O)C/[N+]([O-])=C/c1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-2-11(14)12(15)9-13(16)8-10-6-4-3-5-7-10/h2-8,11-12,14-15H,1,9H2/b13-8-/t11-,12+/m0/s1 |
| InChIKey | LVDLVLVHXLUYGG-WJOSTPCTSA-N |
| XLogP | 0.52 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|