C24H39BO2 — CID 177476081
2-[1-(1-adamantylmethyl)-3-methylidenecyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 177476081) has the molecular formula C24H39BO2 and a molecular weight of 370.39 g/mol. Its IUPAC name is 2-[1-(1-adamantylmethyl)-3-methylidenecyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-(1-adamantylmethyl)-3-methylidenecyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177476081 |
| Molecular Formula | C24H39BO2 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | 2-[1-(1-adamantylmethyl)-3-methylidenecyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C1CCCC(CC23CC4CC(CC(C4)C2)C3)(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C24H39BO2/c1-17-7-6-8-24(12-17,25-26-21(2,3)22(4,5)27-25)16-23-13-18-9-19(14-23)11-20(10-18)15-23/h18-20H,1,6-16H2,2-5H3 |
| InChIKey | REMUUKHCZFKEMV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|