C34H53F3N2+2 — CID 177476594
trimethyl-[6-[2-(1,1,1-trifluoropropan-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl]azanium (PubChem CID 177476594) has the molecular formula C34H53F3N2+2 and a molecular weight of 546.81 g/mol. Its IUPAC name is trimethyl-[6-[2-(1,1,1-trifluoropropan-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl]azanium.
| Compound Name | trimethyl-[6-[2-(1,1,1-trifluoropropan-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl]azanium |
|---|---|
| PubChem CID | 177476594 |
| Molecular Formula | C34H53F3N2+2 |
| Molecular Weight | 546.81 g/mol |
| Exact Mass | 546.41 |
| IUPAC Name | trimethyl-[6-[2-(1,1,1-trifluoropropan-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl]azanium |
| SMILES | CC(c1ccc2c(c1)C(CCCCCC[N+](C)(C)C)(CCCCCC[N+](C)(C)C)c1ccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C34H53F3N2/c1-27(34(35,36)37)28-20-21-30-29-18-12-13-19-31(29)33(32(30)26-28,22-14-8-10-16-24-38(2,3)4)23-15-9-11-17-25-39(5,6)7/h12-13,18-21,26-27H,8-11,14-17,22-25H2,1-7H3/q+2 |
| InChIKey | BMGWTCKQXQQFPX-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.81 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|