C30H52N3O10P — CID 177477628
[(2R)-3-[[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate (PubChem CID 177477628) has the molecular formula C30H52N3O10P and a molecular weight of 645.73 g/mol. Its IUPAC name is [(2R)-3-[[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-3-[[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 177477628 |
| Molecular Formula | C30H52N3O10P |
| Molecular Weight | 645.73 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | [(2R)-3-[[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C30H52N3O10P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-29(36)40-21-24(34)22-41-44(38,39)42-23-26-25(35)20-28(43-26)33-19-18-27(31)32-30(33)37/h9-10,18-19,24-26,28,34-35H,2-8,11-17,20-23H2,1H3,(H,38,39)(H2,31,32,37)/b10-9-/t24-,25+,26-,28-/m1/s1 |
| InChIKey | UURXRNOWINGLLI-ROMMJBTESA-N |
| XLogP | 4.55 |
| TPSA | 192.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.73 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|