(Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid

C13H13NO4 — CID 177477909

IUPAC(Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid
SMILESC/C(=C(\C(=O)O)N1CCOC1=O)c1ccccc1
InChIInChI=1S/C13H13NO4/c1-9(10-5-3-2-4-6-10)11(12(15)16)14-7-8-18-13(14)17/h2-6H,7-8H2,1H3,(H,15,16)/b11-9-
InChIKeyTXABMHNWHPQFFY-LUAWRHEFSA-N
MW247.25 g/mol
LogP1.95
Rot. Bonds3

About (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid

(Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid (PubChem CID 177477909) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid.

Molecular Properties

Compound Name(Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid
PubChem CID177477909
Molecular FormulaC13H13NO4
Molecular Weight247.25 g/mol
Exact Mass247.08
IUPAC Name(Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid
SMILESC/C(=C(\C(=O)O)N1CCOC1=O)c1ccccc1
InChIInChI=1S/C13H13NO4/c1-9(10-5-3-2-4-6-10)11(12(15)16)14-7-8-18-13(14)17/h2-6H,7-8H2,1H3,(H,15,16)/b11-9-
InChIKeyTXABMHNWHPQFFY-LUAWRHEFSA-N
XLogP1.95
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid?
The IUPAC name of (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid (CID 177477909) is (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid.
What is the SMILES notation for (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid?
The canonical SMILES for (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid is C/C(=C(\C(=O)O)N1CCOC1=O)c1ccccc1.
What is the InChIKey of (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid?
The InChIKey is TXABMHNWHPQFFY-LUAWRHEFSA-N. The full InChI is InChI=1S/C13H13NO4/c1-9(10-5-3-2-4-6-10)11(12(15)16)14-7-8-18-13(14)17/h2-6H,7-8H2,1H3,(H,15,16)/b11-9-.
What are the key properties of (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid?
(Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid has a molecular weight of 247.25 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2-oxo-1,3-oxazolidin-3-yl)-3-phenylbut-2-enoic acid is sourced from PubChem (CID 177477909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).