C24H48N2O4Sn — CID 177480377
(Z)-N,N'-dimethoxy-N,N'-dimethyl-4-tributylstannyloct-4-enediamide (PubChem CID 177480377) has the molecular formula C24H48N2O4Sn and a molecular weight of 547.37 g/mol. Its IUPAC name is (Z)-N,N'-dimethoxy-N,N'-dimethyl-4-tributylstannyloct-4-enediamide.
| Compound Name | (Z)-N,N'-dimethoxy-N,N'-dimethyl-4-tributylstannyloct-4-enediamide |
|---|---|
| PubChem CID | 177480377 |
| Molecular Formula | C24H48N2O4Sn |
| Molecular Weight | 547.37 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | (Z)-N,N'-dimethoxy-N,N'-dimethyl-4-tributylstannyloct-4-enediamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\CCC(=O)N(C)OC)CCC(=O)N(C)OC |
| InChI | InChI=1S/C12H21N2O4.3C4H9.Sn/c1-13(17-3)11(15)9-7-5-6-8-10-12(16)14(2)18-4;3*1-3-4-2;/h5H,7-10H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | WQPFRPRUVJCSMP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.37 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|