About [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium
[4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium (PubChem CID 162387878) has the molecular formula C6H11N2O3Pd-
and a molecular weight of 265.58 g/mol. Its IUPAC name is [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium.
Molecular Properties
| Compound Name | [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium |
| PubChem CID | 162387878 |
| Molecular Formula | C6H11N2O3Pd- |
| Molecular Weight | 265.58 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium |
| SMILES | CON(C)C(=O)CCC([NH-])=O.[Pd] |
| InChI | InChI=1S/C6H12N2O3.Pd/c1-8(11-2)6(10)4-3-5(7)9;/h3-4H2,1-2H3,(H2,7,9);/p-1 |
| InChIKey | KJCFHDKHEGKYGC-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 70.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.58 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium?
The IUPAC name of [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium (CID 162387878) is [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium.
What is the SMILES notation for [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium?
The canonical SMILES for [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium is CON(C)C(=O)CCC([NH-])=O.[Pd].
What is the InChIKey of [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium?
The InChIKey is KJCFHDKHEGKYGC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12N2O3.Pd/c1-8(11-2)6(10)4-3-5(7)9;/h3-4H2,1-2H3,(H2,7,9);/p-1.
What are the key properties of [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium?
[4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium has a molecular weight of 265.58 g/mol, XLogP of 0.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[methoxy(methyl)amino]-4-oxobutanoyl]azanide;palladium is sourced from PubChem (CID 162387878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).