C23H18N2O5 — CID 177481202
(1S,2R,13R,14S,15R)-3-benzyl-4,12-dioxo-18-oxa-3,11-diazapentacyclo[13.2.1.01,13.02,11.05,10]octadeca-5,7,9,16-tetraene-14-carboxylic acid (PubChem CID 177481202) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is (1S,2R,13R,14S,15R)-3-benzyl-4,12-dioxo-18-oxa-3,11-diazapentacyclo[13.2.1.01,13.02,11.05,10]octadeca-5,7,9,16-tetraene-14-carboxylic acid.
| Compound Name | (1S,2R,13R,14S,15R)-3-benzyl-4,12-dioxo-18-oxa-3,11-diazapentacyclo[13.2.1.01,13.02,11.05,10]octadeca-5,7,9,16-tetraene-14-carboxylic acid |
|---|---|
| PubChem CID | 177481202 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (1S,2R,13R,14S,15R)-3-benzyl-4,12-dioxo-18-oxa-3,11-diazapentacyclo[13.2.1.01,13.02,11.05,10]octadeca-5,7,9,16-tetraene-14-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H]2C(=O)N3c4ccccc4C(=O)N(Cc4ccccc4)[C@H]3[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C23H18N2O5/c26-19-14-8-4-5-9-15(14)25-20(27)18-17(21(28)29)16-10-11-23(18,30-16)22(25)24(19)12-13-6-2-1-3-7-13/h1-11,16-18,22H,12H2,(H,28,29)/t16-,17-,18+,22-,23+/m1/s1 |
| InChIKey | BAZOIFVYSSLGMS-BZVMJTILSA-N |
| XLogP | 2.04 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|