C14H20 — CID 177482079
(1E,2Z)-1,2-bis(but-3-enylidene)cyclohexane (PubChem CID 177482079) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (1E,2Z)-1,2-bis(but-3-enylidene)cyclohexane.
| Compound Name | (1E,2Z)-1,2-bis(but-3-enylidene)cyclohexane |
|---|---|
| PubChem CID | 177482079 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (1E,2Z)-1,2-bis(but-3-enylidene)cyclohexane |
| SMILES | C=CC/C=C1/CCCC/C1=C\CC=C |
| InChI | InChI=1S/C14H20/c1-3-5-9-13-11-7-8-12-14(13)10-6-4-2/h3-4,9-10H,1-2,5-8,11-12H2/b13-9-,14-10+ |
| InChIKey | ZHOAPDPXLZMJDI-ZKLMZBBOSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|