C25H36O5 — CID 177482562
(6E)-5-hydroxy-6-(1-hydroxy-2-methylbutylidene)-4-[(1S,2S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione (PubChem CID 177482562) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (6E)-5-hydroxy-6-(1-hydroxy-2-methylbutylidene)-4-[(1S,2S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione.
| Compound Name | (6E)-5-hydroxy-6-(1-hydroxy-2-methylbutylidene)-4-[(1S,2S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 177482562 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (6E)-5-hydroxy-6-(1-hydroxy-2-methylbutylidene)-4-[(1S,2S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione |
| SMILES | C=C(C)C1CC[C@](C)(O)[C@@H]1C1=C(O)/C(=C(\O)C(C)CC)C(=O)C(CC=C(C)C)C1=O |
| InChI | InChI=1S/C25H36O5/c1-8-15(6)21(26)19-23(28)17(10-9-13(2)3)22(27)18(24(19)29)20-16(14(4)5)11-12-25(20,7)30/h9,15-17,20,26,29-30H,4,8,10-12H2,1-3,5-7H3/b21-19-/t15?,16?,17?,20-,25-/m0/s1 |
| InChIKey | IAXXUDSCVDXQEE-NIJMLMHZSA-N |
| XLogP | 5.13 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|