C27H38O7 — CID 56641419
(1S,2R,5R,6S,8S)-5-hydroxy-8-[(1S,4R,6S,7R)-7-hydroxy-4-methyl-1-[(2S)-2-methylbutanoyl]-3-oxo-6-prop-1-en-2-yl-2-oxabicyclo[2.2.1]heptan-7-yl]-1,5-dimethyl-10-oxatricyclo[6.2.1.02,6]undecan-9-one (PubChem CID 56641419) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is (1S,2R,5R,6S,8S)-5-hydroxy-8-[(1S,4R,6S,7R)-7-hydroxy-4-methyl-1-[(2S)-2-methylbutanoyl]-3-oxo-6-prop-1-en-2-yl-2-oxabicyclo[2.2.1]heptan-7-yl]-1,5-dimethyl-10-oxatricyclo[6.2.1.02,6]undecan-9-one.
| Compound Name | (1S,2R,5R,6S,8S)-5-hydroxy-8-[(1S,4R,6S,7R)-7-hydroxy-4-methyl-1-[(2S)-2-methylbutanoyl]-3-oxo-6-prop-1-en-2-yl-2-oxabicyclo[2.2.1]heptan-7-yl]-1,5-dimethyl-10-oxatricyclo[6.2.1.02,6]undecan-9-one |
|---|---|
| PubChem CID | 56641419 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (1S,2R,5R,6S,8S)-5-hydroxy-8-[(1S,4R,6S,7R)-7-hydroxy-4-methyl-1-[(2S)-2-methylbutanoyl]-3-oxo-6-prop-1-en-2-yl-2-oxabicyclo[2.2.1]heptan-7-yl]-1,5-dimethyl-10-oxatricyclo[6.2.1.02,6]undecan-9-one |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)C(=O)O[C@]1(C(=O)[C@@H](C)CC)[C@]2(O)[C@]12C[C@H]3[C@@H](CC[C@@]3(C)O)[C@](C)(C1)OC2=O |
| InChI | InChI=1S/C27H38O7/c1-8-15(4)19(28)26-17(14(2)3)11-22(5,20(29)34-26)27(26,32)25-12-18-16(9-10-23(18,6)31)24(7,13-25)33-21(25)30/h15-18,31-32H,2,8-13H2,1,3-7H3/t15-,16+,17-,18-,22-,23+,24-,25+,26+,27+/m0/s1 |
| InChIKey | NNSXGTYAMNFLKA-FHJNISCYSA-N |
| XLogP | 3.10 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|