C12H16O6S — CID 177483159
[(E)-3,3-dimethoxy-1-phenylprop-1-en-2-yl] methyl sulfate (PubChem CID 177483159) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is [(E)-3,3-dimethoxy-1-phenylprop-1-en-2-yl] methyl sulfate.
| Compound Name | [(E)-3,3-dimethoxy-1-phenylprop-1-en-2-yl] methyl sulfate |
|---|---|
| PubChem CID | 177483159 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [(E)-3,3-dimethoxy-1-phenylprop-1-en-2-yl] methyl sulfate |
| SMILES | COC(OC)/C(=C\c1ccccc1)OS(=O)(=O)OC |
| InChI | InChI=1S/C12H16O6S/c1-15-12(16-2)11(18-19(13,14)17-3)9-10-7-5-4-6-8-10/h4-9,12H,1-3H3/b11-9+ |
| InChIKey | JALMLPMMFVVEBT-PKNBQFBNSA-N |
| XLogP | 1.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|