C21H16ClN3O2 — CID 177483266
(2Z)-2-(4-chlorophenyl)-4-[4-(4-methylphenyl)-3,5-dioxopyrazolidin-1-yl]penta-2,4-dienenitrile (PubChem CID 177483266) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is (2Z)-2-(4-chlorophenyl)-4-[4-(4-methylphenyl)-3,5-dioxopyrazolidin-1-yl]penta-2,4-dienenitrile.
| Compound Name | (2Z)-2-(4-chlorophenyl)-4-[4-(4-methylphenyl)-3,5-dioxopyrazolidin-1-yl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 177483266 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2Z)-2-(4-chlorophenyl)-4-[4-(4-methylphenyl)-3,5-dioxopyrazolidin-1-yl]penta-2,4-dienenitrile |
| SMILES | C=C(/C=C(\C#N)c1ccc(Cl)cc1)N1NC(=O)C(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C21H16ClN3O2/c1-13-3-5-16(6-4-13)19-20(26)24-25(21(19)27)14(2)11-17(12-23)15-7-9-18(22)10-8-15/h3-11,19H,2H2,1H3,(H,24,26)/b17-11+ |
| InChIKey | POYHBCPOAILFRK-GZTJUZNOSA-N |
| XLogP | 3.73 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|