C13H7ClN4O2 — CID 137004062
6-(4-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 137004062) has the molecular formula C13H7ClN4O2 and a molecular weight of 286.68 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile.
| Compound Name | 6-(4-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 137004062 |
| Molecular Formula | C13H7ClN4O2 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 6-(4-chlorophenyl)-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| SMILES | N#Cc1cnn2c1NC(=O)C(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C13H7ClN4O2/c14-9-3-1-7(2-4-9)10-12(19)17-11-8(5-15)6-16-18(11)13(10)20/h1-4,6,10H,(H,17,19) |
| InChIKey | NLCFLMABUQIRLU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|