C13H11ClN4O3 — CID 136775594
6-(4-chlorophenyl)-2-ethoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 136775594) has the molecular formula C13H11ClN4O3 and a molecular weight of 306.71 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-ethoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | 6-(4-chlorophenyl)-2-ethoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 136775594 |
| Molecular Formula | C13H11ClN4O3 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 6-(4-chlorophenyl)-2-ethoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | CCOc1nc2n(n1)C(=O)C(c1ccc(Cl)cc1)C(=O)N2 |
| InChI | InChI=1S/C13H11ClN4O3/c1-2-21-13-16-12-15-10(19)9(11(20)18(12)17-13)7-3-5-8(14)6-4-7/h3-6,9H,2H2,1H3,(H,15,16,17,19) |
| InChIKey | LDUKHINNXJLQHT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|