C8H10N4O3 — CID 136773998
6-ethyl-2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 136773998) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 6-ethyl-2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | 6-ethyl-2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 136773998 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 6-ethyl-2-methoxy-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | CCC1C(=O)Nc2nc(OC)nn2C1=O |
| InChI | InChI=1S/C8H10N4O3/c1-3-4-5(13)9-7-10-8(15-2)11-12(7)6(4)14/h4H,3H2,1-2H3,(H,9,10,11,13) |
| InChIKey | OHNPPJGUJBNIIJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|