C28H46N2O6 — CID 177483286
hexyl (Z)-2-[[(1S,2R)-2-[[(E)-2-hexoxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 177483286) has the molecular formula C28H46N2O6 and a molecular weight of 506.68 g/mol. Its IUPAC name is hexyl (Z)-2-[[(1S,2R)-2-[[(E)-2-hexoxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | hexyl (Z)-2-[[(1S,2R)-2-[[(E)-2-hexoxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 177483286 |
| Molecular Formula | C28H46N2O6 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | hexyl (Z)-2-[[(1S,2R)-2-[[(E)-2-hexoxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | CCCCCCOC(=O)C(/C=N/[C@H]1CCCC[C@H]1/N=C/C(C(=O)OCCCCCC)=C(/C)O)=C(/C)O |
| InChI | InChI=1S/C28H46N2O6/c1-5-7-9-13-17-35-27(33)23(21(3)31)19-29-25-15-11-12-16-26(25)30-20-24(22(4)32)28(34)36-18-14-10-8-6-2/h19-20,25-26,31-32H,5-18H2,1-4H3/b23-21-,24-22+,29-19+,30-20+/t25-,26+/m0/s1 |
| InChIKey | HDXITFIWMXPEHH-GJNBNEIUSA-N |
| XLogP | 6.35 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|