C20H18N2O6 — CID 177483809
methyl (Z)-2-cyano-3-[3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-4-(2-ethenoxyethoxy)phenyl]prop-2-enoate (PubChem CID 177483809) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is methyl (Z)-2-cyano-3-[3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-4-(2-ethenoxyethoxy)phenyl]prop-2-enoate.
| Compound Name | methyl (Z)-2-cyano-3-[3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-4-(2-ethenoxyethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 177483809 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl (Z)-2-cyano-3-[3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-4-(2-ethenoxyethoxy)phenyl]prop-2-enoate |
| SMILES | C=COCCOc1ccc(/C=C(/C#N)C(=O)OC)cc1/C=C(\C#N)C(=O)OC |
| InChI | InChI=1S/C20H18N2O6/c1-4-27-7-8-28-18-6-5-14(10-16(12-21)19(23)25-2)9-15(18)11-17(13-22)20(24)26-3/h4-6,9-11H,1,7-8H2,2-3H3/b16-10-,17-11+ |
| InChIKey | BHIDBYLBGHQQHC-VRNBXGKJSA-N |
| XLogP | 2.39 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|